C16H15F3N4OS — CID 11523522
N-[3-(diaminomethylideneamino)-4-methylphenyl]-3-(trifluoromethylsulfanyl)benzamide (PubChem CID 11523522) has the molecular formula C16H15F3N4OS and a molecular weight of 368.38 g/mol. Its IUPAC name is N-[3-(diaminomethylideneamino)-4-methylphenyl]-3-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[3-(diaminomethylideneamino)-4-methylphenyl]-3-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 11523522 |
| Molecular Formula | C16H15F3N4OS |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[3-(diaminomethylideneamino)-4-methylphenyl]-3-(trifluoromethylsulfanyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(SC(F)(F)F)c2)cc1N=C(N)N |
| InChI | InChI=1S/C16H15F3N4OS/c1-9-5-6-11(8-13(9)23-15(20)21)22-14(24)10-3-2-4-12(7-10)25-16(17,18)19/h2-8H,1H3,(H,22,24)(H4,20,21,23) |
| InChIKey | UXBAAGMRURXBKM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|