C22H22ClN5O4 — CID 18613459
[4-chloro-5-(dimethylamino)-2-[[3-[3-(2-methylpyrazol-3-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid (PubChem CID 18613459) has the molecular formula C22H22ClN5O4 and a molecular weight of 455.90 g/mol. Its IUPAC name is [4-chloro-5-(dimethylamino)-2-[[3-[3-(2-methylpyrazol-3-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid.
| Compound Name | [4-chloro-5-(dimethylamino)-2-[[3-[3-(2-methylpyrazol-3-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 18613459 |
| Molecular Formula | C22H22ClN5O4 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | [4-chloro-5-(dimethylamino)-2-[[3-[3-(2-methylpyrazol-3-yl)phenyl]-3-oxopropanoyl]amino]phenyl]carbamic acid |
| SMILES | CN(C)c1cc(NC(=O)O)c(NC(=O)CC(=O)c2cccc(-c3ccnn3C)c2)cc1Cl |
| InChI | InChI=1S/C22H22ClN5O4/c1-27(2)19-11-17(26-22(31)32)16(10-15(19)23)25-21(30)12-20(29)14-6-4-5-13(9-14)18-7-8-24-28(18)3/h4-11,26H,12H2,1-3H3,(H,25,30)(H,31,32) |
| InChIKey | JUUCWUZGJDRQPB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|