C18H16ClN5O4 — CID 18613334
[4-chloro-2-[[3-(2-cyano-4-pyridinyl)-3-oxopropanoyl]amino]-5-(dimethylamino)phenyl]carbamic acid (PubChem CID 18613334) has the molecular formula C18H16ClN5O4 and a molecular weight of 401.81 g/mol. Its IUPAC name is [4-chloro-2-[[3-(2-cyano-4-pyridinyl)-3-oxopropanoyl]amino]-5-(dimethylamino)phenyl]carbamic acid.
| Compound Name | [4-chloro-2-[[3-(2-cyano-4-pyridinyl)-3-oxopropanoyl]amino]-5-(dimethylamino)phenyl]carbamic acid |
|---|---|
| PubChem CID | 18613334 |
| Molecular Formula | C18H16ClN5O4 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [4-chloro-2-[[3-(2-cyano-4-pyridinyl)-3-oxopropanoyl]amino]-5-(dimethylamino)phenyl]carbamic acid |
| SMILES | CN(C)c1cc(NC(=O)O)c(NC(=O)CC(=O)c2ccnc(C#N)c2)cc1Cl |
| InChI | InChI=1S/C18H16ClN5O4/c1-24(2)15-7-14(23-18(27)28)13(6-12(15)19)22-17(26)8-16(25)10-3-4-21-11(5-10)9-20/h3-7,23H,8H2,1-2H3,(H,22,26)(H,27,28) |
| InChIKey | YMVGXNVOSUJDAD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|