C13H7Cl2N3O — CID 112523952
2-cyano-N-(2,4-dichlorophenyl)pyridine-4-carboxamide (PubChem CID 112523952) has the molecular formula C13H7Cl2N3O and a molecular weight of 292.13 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dichlorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-cyano-N-(2,4-dichlorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 112523952 |
| Molecular Formula | C13H7Cl2N3O |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-cyano-N-(2,4-dichlorophenyl)pyridine-4-carboxamide |
| SMILES | N#Cc1cc(C(=O)Nc2ccc(Cl)cc2Cl)ccn1 |
| InChI | InChI=1S/C13H7Cl2N3O/c14-9-1-2-12(11(15)6-9)18-13(19)8-3-4-17-10(5-8)7-16/h1-6H,(H,18,19) |
| InChIKey | WNPPIEDNWQHFHL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |