C22H22Cl2N2O — CID 4731536
2-(1-adamantyl)-N-(2,4-dichlorophenyl)pyridine-4-carboxamide (PubChem CID 4731536) has the molecular formula C22H22Cl2N2O and a molecular weight of 401.34 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2,4-dichlorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(1-adamantyl)-N-(2,4-dichlorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 4731536 |
| Molecular Formula | C22H22Cl2N2O |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(1-adamantyl)-N-(2,4-dichlorophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccnc(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H22Cl2N2O/c23-17-1-2-19(18(24)9-17)26-21(27)16-3-4-25-20(8-16)22-10-13-5-14(11-22)7-15(6-13)12-22/h1-4,8-9,13-15H,5-7,10-12H2,(H,26,27) |
| InChIKey | RLPXBYDWPZGJDB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |