C22H23IN2O — CID 4731524
2-(1-adamantyl)-N-(4-iodophenyl)pyridine-4-carboxamide (PubChem CID 4731524) has the molecular formula C22H23IN2O and a molecular weight of 458.34 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(4-iodophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(1-adamantyl)-N-(4-iodophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 4731524 |
| Molecular Formula | C22H23IN2O |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-(1-adamantyl)-N-(4-iodophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1ccnc(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H23IN2O/c23-18-1-3-19(4-2-18)25-21(26)17-5-6-24-20(10-17)22-11-14-7-15(12-22)9-16(8-14)13-22/h1-6,10,14-16H,7-9,11-13H2,(H,25,26) |
| InChIKey | NDWNNYFOCWXJFX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|