C23H24N4O4 — CID 4731545
2-(1-adamantyl)-N'-(2-nitrobenzoyl)pyridine-4-carbohydrazide (PubChem CID 4731545) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-(2-nitrobenzoyl)pyridine-4-carbohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-(2-nitrobenzoyl)pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 4731545 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-(1-adamantyl)-N'-(2-nitrobenzoyl)pyridine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1[N+](=O)[O-])c1ccnc(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C23H24N4O4/c28-21(25-26-22(29)18-3-1-2-4-19(18)27(30)31)17-5-6-24-20(10-17)23-11-14-7-15(12-23)9-16(8-14)13-23/h1-6,10,14-16H,7-9,11-13H2,(H,25,28)(H,26,29) |
| InChIKey | HGGCDJOHEVLAIC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|