C18H20ClNO3 — CID 70673254
tert-butyl 2-[4-chloro-2-(2-methyl-3-pyridinyl)phenoxy]acetate (PubChem CID 70673254) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is tert-butyl 2-[4-chloro-2-(2-methyl-3-pyridinyl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-chloro-2-(2-methyl-3-pyridinyl)phenoxy]acetate |
|---|---|
| PubChem CID | 70673254 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | tert-butyl 2-[4-chloro-2-(2-methyl-3-pyridinyl)phenoxy]acetate |
| SMILES | Cc1ncccc1-c1cc(Cl)ccc1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H20ClNO3/c1-12-14(6-5-9-20-12)15-10-13(19)7-8-16(15)22-11-17(21)23-18(2,3)4/h5-10H,11H2,1-4H3 |
| InChIKey | LXIYKHHFIDTILB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |