C15H12ClNO3S — CID 46865878
2-[4-chloro-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]phenoxy]acetic acid (PubChem CID 46865878) has the molecular formula C15H12ClNO3S and a molecular weight of 321.79 g/mol. Its IUPAC name is 2-[4-chloro-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 46865878 |
| Molecular Formula | C15H12ClNO3S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-[4-chloro-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethynyl]phenoxy]acetic acid |
| SMILES | Cc1nc(C)c(C#Cc2cc(Cl)ccc2OCC(=O)O)s1 |
| InChI | InChI=1S/C15H12ClNO3S/c1-9-14(21-10(2)17-9)6-3-11-7-12(16)4-5-13(11)20-8-15(18)19/h4-5,7H,8H2,1-2H3,(H,18,19) |
| InChIKey | ADKPLSNFYHAPDO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|