C22H15ClO5S — CID 67008464
2-[4-chloro-2-[2-(5,5-dihydroxydibenzothiophen-3-yl)ethynyl]phenoxy]acetic acid (PubChem CID 67008464) has the molecular formula C22H15ClO5S and a molecular weight of 426.88 g/mol. Its IUPAC name is 2-[4-chloro-2-[2-(5,5-dihydroxydibenzothiophen-3-yl)ethynyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[2-(5,5-dihydroxydibenzothiophen-3-yl)ethynyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67008464 |
| Molecular Formula | C22H15ClO5S |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2-[4-chloro-2-[2-(5,5-dihydroxydibenzothiophen-3-yl)ethynyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Cl)cc1C#Cc1ccc2c(c1)S(O)(O)c1ccccc1-2 |
| InChI | InChI=1S/C22H15ClO5S/c23-16-8-10-19(28-13-22(24)25)15(12-16)7-5-14-6-9-18-17-3-1-2-4-20(17)29(26,27)21(18)11-14/h1-4,6,8-12,26-27H,13H2,(H,24,25) |
| InChIKey | YRWTWJRGMJAUHK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|