C18H16ClNO5S — CID 46865090
2-[4-chloro-2-[2-[5-(methanesulfonamido)-2-methylphenyl]ethynyl]phenoxy]acetic acid (PubChem CID 46865090) has the molecular formula C18H16ClNO5S and a molecular weight of 393.85 g/mol. Its IUPAC name is 2-[4-chloro-2-[2-[5-(methanesulfonamido)-2-methylphenyl]ethynyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[2-[5-(methanesulfonamido)-2-methylphenyl]ethynyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 46865090 |
| Molecular Formula | C18H16ClNO5S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-[4-chloro-2-[2-[5-(methanesulfonamido)-2-methylphenyl]ethynyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(NS(C)(=O)=O)cc1C#Cc1cc(Cl)ccc1OCC(=O)O |
| InChI | InChI=1S/C18H16ClNO5S/c1-12-3-7-16(20-26(2,23)24)10-13(12)4-5-14-9-15(19)6-8-17(14)25-11-18(21)22/h3,6-10,20H,11H2,1-2H3,(H,21,22) |
| InChIKey | KNYVMJMHWRMOGM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|