C21H21NO6S — CID 91419106
2-[2-[2-[5-(2-hydroxyethylsulfonyl)-2-methylphenyl]ethynyl]-4-(methyliminomethyl)phenoxy]acetic acid (PubChem CID 91419106) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[2-[2-[5-(2-hydroxyethylsulfonyl)-2-methylphenyl]ethynyl]-4-(methyliminomethyl)phenoxy]acetic acid.
| Compound Name | 2-[2-[2-[5-(2-hydroxyethylsulfonyl)-2-methylphenyl]ethynyl]-4-(methyliminomethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 91419106 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[2-[2-[5-(2-hydroxyethylsulfonyl)-2-methylphenyl]ethynyl]-4-(methyliminomethyl)phenoxy]acetic acid |
| SMILES | C/N=C/c1ccc(OCC(=O)O)c(C#Cc2cc(S(=O)(=O)CCO)ccc2C)c1 |
| InChI | InChI=1S/C21H21NO6S/c1-15-3-7-19(29(26,27)10-9-23)12-17(15)5-6-18-11-16(13-22-2)4-8-20(18)28-14-21(24)25/h3-4,7-8,11-13,23H,9-10,14H2,1-2H3,(H,24,25)/b22-13+ |
| InChIKey | UXPQXUBFKZIRHO-LPYMAVHISA-N |
| XLogP | 1.67 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|