C17H28O3P+ — CID 169040458
[(3,5-ditert-butyl-4-hydroxyphenyl)-methoxymethyl]-methyl-oxophosphanium (PubChem CID 169040458) has the molecular formula C17H28O3P+ and a molecular weight of 311.38 g/mol. Its IUPAC name is [(3,5-ditert-butyl-4-hydroxyphenyl)-methoxymethyl]-methyl-oxophosphanium.
| Compound Name | [(3,5-ditert-butyl-4-hydroxyphenyl)-methoxymethyl]-methyl-oxophosphanium |
|---|---|
| PubChem CID | 169040458 |
| Molecular Formula | C17H28O3P+ |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | [(3,5-ditert-butyl-4-hydroxyphenyl)-methoxymethyl]-methyl-oxophosphanium |
| SMILES | COC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)[P+](C)=O |
| InChI | InChI=1S/C17H27O3P/c1-16(2,3)12-9-11(15(20-7)21(8)19)10-13(14(12)18)17(4,5)6/h9-10,15H,1-8H3/p+1 |
| InChIKey | WDESYIWLFIXSRH-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|