C26H36N3O7P — CID 88821068
(3,5-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 88821068) has the molecular formula C26H36N3O7P and a molecular weight of 533.56 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 88821068 |
| Molecular Formula | C26H36N3O7P |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(C)c1cc(OP(=O)(O)O)cc(C(C)(C)C)c1O.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C14H23O5P.C12H13N3O2/c1-13(2,3)10-7-9(19-20(16,17)18)8-11(12(10)15)14(4,5)6;16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14/h7-8,15H,1-6H3,(H2,16,17,18);7H,1-6H2 |
| InChIKey | XQEZNLGBQKBJBG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|