C19H21BrN3O6P — CID 87973627
(2-bromo-4-methylphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87973627) has the molecular formula C19H21BrN3O6P and a molecular weight of 498.27 g/mol. Its IUPAC name is (2-bromo-4-methylphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | (2-bromo-4-methylphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87973627 |
| Molecular Formula | C19H21BrN3O6P |
| Molecular Weight | 498.27 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | (2-bromo-4-methylphenyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1ccc(OP(=O)(O)O)c(Br)c1.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C7H8BrO4P/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;1-5-2-3-7(6(8)4-5)12-13(9,10)11/h7H,1-6H2;2-4H,1H3,(H2,9,10,11) |
| InChIKey | GNLTYVCLWBLBTH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|