C45H65N3O6 — CID 87204831
4-[[1,6-bis(3,5-ditert-butyl-4-hydroxyphenoxy)-2H-1,3,5-triazin-4-yl]oxy]-2,6-ditert-butylphenol (PubChem CID 87204831) has the molecular formula C45H65N3O6 and a molecular weight of 744.03 g/mol. Its IUPAC name is 4-[[1,6-bis(3,5-ditert-butyl-4-hydroxyphenoxy)-2H-1,3,5-triazin-4-yl]oxy]-2,6-ditert-butylphenol.
| Compound Name | 4-[[1,6-bis(3,5-ditert-butyl-4-hydroxyphenoxy)-2H-1,3,5-triazin-4-yl]oxy]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 87204831 |
| Molecular Formula | C45H65N3O6 |
| Molecular Weight | 744.03 g/mol |
| Exact Mass | 743.49 |
| IUPAC Name | 4-[[1,6-bis(3,5-ditert-butyl-4-hydroxyphenoxy)-2H-1,3,5-triazin-4-yl]oxy]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(OC2=NCN(Oc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C(Oc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)=N2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C45H65N3O6/c1-40(2,3)29-19-26(20-30(35(29)49)41(4,5)6)52-38-46-25-48(54-28-23-33(44(13,14)15)37(51)34(24-28)45(16,17)18)39(47-38)53-27-21-31(42(7,8)9)36(50)32(22-27)43(10,11)12/h19-24,49-51H,25H2,1-18H3 |
| InChIKey | INVPAKDGRGSBLB-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.03 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |