C44H68N2O6 — CID 3542611
3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[2-[[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-4-oxobut-2-en-2-yl]amino]ethylamino]but-2-enoate (PubChem CID 3542611) has the molecular formula C44H68N2O6 and a molecular weight of 721.04 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[2-[[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-4-oxobut-2-en-2-yl]amino]ethylamino]but-2-enoate.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[2-[[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-4-oxobut-2-en-2-yl]amino]ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 3542611 |
| Molecular Formula | C44H68N2O6 |
| Molecular Weight | 721.04 g/mol |
| Exact Mass | 720.51 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-[2-[[4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propoxy]-4-oxobut-2-en-2-yl]amino]ethylamino]but-2-enoate |
| SMILES | CC(=CC(=O)OCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)NCCNC(C)=CC(=O)OCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C44H68N2O6/c1-29(23-37(47)51-21-15-17-31-25-33(41(3,4)5)39(49)34(26-31)42(6,7)8)45-19-20-46-30(2)24-38(48)52-22-16-18-32-27-35(43(9,10)11)40(50)36(28-32)44(12,13)14/h23-28,45-46,49-50H,15-22H2,1-14H3 |
| InChIKey | JHSZDLUOFMRPIS-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.04 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|