C15H12ClI — CID 139958810
7-chloro-1-iodo-9,9-dimethylfluorene (PubChem CID 139958810) has the molecular formula C15H12ClI and a molecular weight of 354.62 g/mol. Its IUPAC name is 7-chloro-1-iodo-9,9-dimethylfluorene.
| Compound Name | 7-chloro-1-iodo-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 139958810 |
| Molecular Formula | C15H12ClI |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 7-chloro-1-iodo-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(Cl)ccc2-c2cccc(I)c21 |
| InChI | InChI=1S/C15H12ClI/c1-15(2)12-8-9(16)6-7-10(12)11-4-3-5-13(17)14(11)15/h3-8H,1-2H3 |
| InChIKey | UBTHWVSTVGOFLZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|