C17H17FO — CID 175802586
7-fluoro-2-methoxy-10,10-dimethyl-9H-phenanthrene (PubChem CID 175802586) has the molecular formula C17H17FO and a molecular weight of 256.32 g/mol. Its IUPAC name is 7-fluoro-2-methoxy-10,10-dimethyl-9H-phenanthrene.
| Compound Name | 7-fluoro-2-methoxy-10,10-dimethyl-9H-phenanthrene |
|---|---|
| PubChem CID | 175802586 |
| Molecular Formula | C17H17FO |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 7-fluoro-2-methoxy-10,10-dimethyl-9H-phenanthrene |
| SMILES | COc1ccc2c(c1)C(C)(C)Cc1cc(F)ccc1-2 |
| InChI | InChI=1S/C17H17FO/c1-17(2)10-11-8-12(18)4-6-14(11)15-7-5-13(19-3)9-16(15)17/h4-9H,10H2,1-3H3 |
| InChIKey | ZRHSIOHCJSZMPH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |