About (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile
(2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile (PubChem CID 70237051) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile.
Molecular Properties
| Compound Name | (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile |
| PubChem CID | 70237051 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile |
| SMILES | COc1ccc2c(c1)/C(=C\C#N)C(C)(C)C2 |
| InChI | InChI=1S/C14H15NO/c1-14(2)9-10-4-5-11(16-3)8-12(10)13(14)6-7-15/h4-6,8H,9H2,1-3H3/b13-6+ |
| InChIKey | MPGZEWHQLXPXAK-AWNIVKPZSA-N |
| XLogP | 3.18 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile?
The IUPAC name of (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile (CID 70237051) is (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile.
What is the SMILES notation for (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile?
The canonical SMILES for (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile is COc1ccc2c(c1)/C(=C\C#N)C(C)(C)C2.
What is the InChIKey of (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile?
The InChIKey is MPGZEWHQLXPXAK-AWNIVKPZSA-N. The full InChI is InChI=1S/C14H15NO/c1-14(2)9-10-4-5-11(16-3)8-12(10)13(14)6-7-15/h4-6,8H,9H2,1-3H3/b13-6+.
What are the key properties of (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile?
(2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile has a molecular weight of 213.28 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(6-methoxy-2,2-dimethyl-3H-inden-1-ylidene)acetonitrile is sourced from PubChem (CID 70237051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).