C20H23N3O2S — CID 134252977
2-[(9-methoxy-5,5-dimethyl-4-prop-2-enoxy-4,6-dihydro-1H-benzo[h]quinazolin-2-yl)sulfanyl]acetonitrile (PubChem CID 134252977) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[(9-methoxy-5,5-dimethyl-4-prop-2-enoxy-4,6-dihydro-1H-benzo[h]quinazolin-2-yl)sulfanyl]acetonitrile.
| Compound Name | 2-[(9-methoxy-5,5-dimethyl-4-prop-2-enoxy-4,6-dihydro-1H-benzo[h]quinazolin-2-yl)sulfanyl]acetonitrile |
|---|---|
| PubChem CID | 134252977 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[(9-methoxy-5,5-dimethyl-4-prop-2-enoxy-4,6-dihydro-1H-benzo[h]quinazolin-2-yl)sulfanyl]acetonitrile |
| SMILES | C=CCOC1N=C(SCC#N)NC2=C1C(C)(C)Cc1ccc(OC)cc12 |
| InChI | InChI=1S/C20H23N3O2S/c1-5-9-25-18-16-17(22-19(23-18)26-10-8-21)15-11-14(24-4)7-6-13(15)12-20(16,2)3/h5-7,11,18H,1,9-10,12H2,2-4H3,(H,22,23) |
| InChIKey | XZXWXQGRXCOHKD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|