C28H26O3 — CID 11058675
(3S)-5',6-dimethoxy-3'-(4-prop-2-enoxyphenyl)spiro[1,2-dihydroindene-3,1'-indene] (PubChem CID 11058675) has the molecular formula C28H26O3 and a molecular weight of 410.51 g/mol. Its IUPAC name is (3S)-5',6-dimethoxy-3'-(4-prop-2-enoxyphenyl)spiro[1,2-dihydroindene-3,1'-indene].
| Compound Name | (3S)-5',6-dimethoxy-3'-(4-prop-2-enoxyphenyl)spiro[1,2-dihydroindene-3,1'-indene] |
|---|---|
| PubChem CID | 11058675 |
| Molecular Formula | C28H26O3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (3S)-5',6-dimethoxy-3'-(4-prop-2-enoxyphenyl)spiro[1,2-dihydroindene-3,1'-indene] |
| SMILES | C=CCOc1ccc(C2=C[C@]3(CCc4cc(OC)ccc43)c3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C28H26O3/c1-4-15-31-21-7-5-19(6-8-21)25-18-28(27-12-10-23(30-3)17-24(25)27)14-13-20-16-22(29-2)9-11-26(20)28/h4-12,16-18H,1,13-15H2,2-3H3/t28-/m0/s1 |
| InChIKey | LPXQIZPLAZMEPD-NDEPHWFRSA-N |
| XLogP | 5.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|