C22H24O2 — CID 68754223
5-ethenyl-6-(4-ethoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulene (PubChem CID 68754223) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 5-ethenyl-6-(4-ethoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulene.
| Compound Name | 5-ethenyl-6-(4-ethoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulene |
|---|---|
| PubChem CID | 68754223 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 5-ethenyl-6-(4-ethoxyphenyl)-2-methoxy-8,9-dihydro-7H-benzo[7]annulene |
| SMILES | C=CC1=C(c2ccc(OCC)cc2)CCCc2cc(OC)ccc21 |
| InChI | InChI=1S/C22H24O2/c1-4-20-21(16-9-11-18(12-10-16)24-5-2)8-6-7-17-15-19(23-3)13-14-22(17)20/h4,9-15H,1,5-8H2,2-3H3 |
| InChIKey | UMYBZGNRVGGODS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|