C24H26O2 — CID 141373616
2-methoxy-6-(4-methoxyphenyl)-5-pent-1-ynyl-8,9-dihydro-7H-benzo[7]annulene (PubChem CID 141373616) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-methoxy-6-(4-methoxyphenyl)-5-pent-1-ynyl-8,9-dihydro-7H-benzo[7]annulene.
| Compound Name | 2-methoxy-6-(4-methoxyphenyl)-5-pent-1-ynyl-8,9-dihydro-7H-benzo[7]annulene |
|---|---|
| PubChem CID | 141373616 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-methoxy-6-(4-methoxyphenyl)-5-pent-1-ynyl-8,9-dihydro-7H-benzo[7]annulene |
| SMILES | CCCC#CC1=C(c2ccc(OC)cc2)CCCc2cc(OC)ccc21 |
| InChI | InChI=1S/C24H26O2/c1-4-5-6-9-24-22(18-11-13-20(25-2)14-12-18)10-7-8-19-17-21(26-3)15-16-23(19)24/h11-17H,4-5,7-8,10H2,1-3H3 |
| InChIKey | DZLKDMUUPLNPPO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|