C19H21FOSi2 — CID 177461672
2-fluoro-7-methoxy-5,5,10,10-tetramethyl-[1]benzosilolo[3,2-b][1]benzosilole (PubChem CID 177461672) has the molecular formula C19H21FOSi2 and a molecular weight of 340.55 g/mol. Its IUPAC name is 2-fluoro-7-methoxy-5,5,10,10-tetramethyl-[1]benzosilolo[3,2-b][1]benzosilole.
| Compound Name | 2-fluoro-7-methoxy-5,5,10,10-tetramethyl-[1]benzosilolo[3,2-b][1]benzosilole |
|---|---|
| PubChem CID | 177461672 |
| Molecular Formula | C19H21FOSi2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-fluoro-7-methoxy-5,5,10,10-tetramethyl-[1]benzosilolo[3,2-b][1]benzosilole |
| SMILES | COc1ccc2c(c1)[Si](C)(C)C1=C2[Si](C)(C)c2cc(F)ccc21 |
| InChI | InChI=1S/C19H21FOSi2/c1-21-13-7-9-15-17(11-13)23(4,5)18-14-8-6-12(20)10-16(14)22(2,3)19(15)18/h6-11H,1-5H3 |
| InChIKey | YIYZROPJJZIYGE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|