C20H18O3 — CID 68850071
7-ethyl-3-methoxybenzo[c]fluorene-5,7-diol (PubChem CID 68850071) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 7-ethyl-3-methoxybenzo[c]fluorene-5,7-diol.
| Compound Name | 7-ethyl-3-methoxybenzo[c]fluorene-5,7-diol |
|---|---|
| PubChem CID | 68850071 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 7-ethyl-3-methoxybenzo[c]fluorene-5,7-diol |
| SMILES | CCC1(O)c2ccccc2-c2c1cc(O)c1cc(OC)ccc21 |
| InChI | InChI=1S/C20H18O3/c1-3-20(22)16-7-5-4-6-14(16)19-13-9-8-12(23-2)10-15(13)18(21)11-17(19)20/h4-11,21-22H,3H2,1-2H3 |
| InChIKey | BTBOZDBTXYOCGB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |