C20H15F3O4 — CID 67228250
2,3-dimethoxy-7-(trifluoromethyl)benzo[c]fluorene-5,7-diol (PubChem CID 67228250) has the molecular formula C20H15F3O4 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2,3-dimethoxy-7-(trifluoromethyl)benzo[c]fluorene-5,7-diol.
| Compound Name | 2,3-dimethoxy-7-(trifluoromethyl)benzo[c]fluorene-5,7-diol |
|---|---|
| PubChem CID | 67228250 |
| Molecular Formula | C20H15F3O4 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2,3-dimethoxy-7-(trifluoromethyl)benzo[c]fluorene-5,7-diol |
| SMILES | COc1cc2c(O)cc3c(c2cc1OC)-c1ccccc1C3(O)C(F)(F)F |
| InChI | InChI=1S/C20H15F3O4/c1-26-16-7-11-12(8-17(16)27-2)18-10-5-3-4-6-13(10)19(25,20(21,22)23)14(18)9-15(11)24/h3-9,24-25H,1-2H3 |
| InChIKey | DKWDSINGBYQMGA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |