C19H17IO3 — CID 163890616
2,3-dimethoxy-7-methylnaphtho[2,1-b][1]benziodol-5-ol (PubChem CID 163890616) has the molecular formula C19H17IO3 and a molecular weight of 420.25 g/mol. Its IUPAC name is 2,3-dimethoxy-7-methylnaphtho[2,1-b][1]benziodol-5-ol.
| Compound Name | 2,3-dimethoxy-7-methylnaphtho[2,1-b][1]benziodol-5-ol |
|---|---|
| PubChem CID | 163890616 |
| Molecular Formula | C19H17IO3 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 2,3-dimethoxy-7-methylnaphtho[2,1-b][1]benziodol-5-ol |
| SMILES | COc1cc2c(O)cc3c(c2cc1OC)-c1ccccc1I3C |
| InChI | InChI=1S/C19H17IO3/c1-20-14-7-5-4-6-11(14)19-13-9-18(23-3)17(22-2)8-12(13)16(21)10-15(19)20/h4-10,21H,1-3H3 |
| InChIKey | QBFMGKFEMCXGTF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|