About 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol
7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol (PubChem CID 170317987) has the molecular formula C23H24O3
and a molecular weight of 348.44 g/mol. Its IUPAC name is 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol.
Molecular Properties
| Compound Name | 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol |
| PubChem CID | 170317987 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol |
| SMILES | CCC1(CC)c2ccccc2-c2c1cc(O)c1cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C23H24O3/c1-5-23(6-2)17-10-8-7-9-14(17)22-16-12-21(26-4)20(25-3)11-15(16)19(24)13-18(22)23/h7-13,24H,5-6H2,1-4H3 |
| InChIKey | CYIYVODMJQPUCU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol?
The IUPAC name of 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol (CID 170317987) is 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol.
What is the SMILES notation for 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol?
The canonical SMILES for 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol is CCC1(CC)c2ccccc2-c2c1cc(O)c1cc(OC)c(OC)cc21.
What is the InChIKey of 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol?
The InChIKey is CYIYVODMJQPUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O3/c1-5-23(6-2)17-10-8-7-9-14(17)22-16-12-21(26-4)20(25-3)11-15(16)19(24)13-18(22)23/h7-13,24H,5-6H2,1-4H3.
What are the key properties of 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol?
7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol has a molecular weight of 348.44 g/mol, XLogP of 5.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-diethyl-2,3-dimethoxybenzo[c]fluoren-5-ol is sourced from PubChem (CID 170317987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).