C26H29NO4 — CID 68841390
7-butyl-3-methoxy-2-morpholin-4-ylbenzo[c]fluorene-5,7-diol (PubChem CID 68841390) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is 7-butyl-3-methoxy-2-morpholin-4-ylbenzo[c]fluorene-5,7-diol.
| Compound Name | 7-butyl-3-methoxy-2-morpholin-4-ylbenzo[c]fluorene-5,7-diol |
|---|---|
| PubChem CID | 68841390 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 7-butyl-3-methoxy-2-morpholin-4-ylbenzo[c]fluorene-5,7-diol |
| SMILES | CCCCC1(O)c2ccccc2-c2c1cc(O)c1cc(OC)c(N3CCOCC3)cc21 |
| InChI | InChI=1S/C26H29NO4/c1-3-4-9-26(29)20-8-6-5-7-17(20)25-19-14-22(27-10-12-31-13-11-27)24(30-2)15-18(19)23(28)16-21(25)26/h5-8,14-16,28-29H,3-4,9-13H2,1-2H3 |
| InChIKey | YOQYRDGWVLPHDP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |