C19H15N3O4 — CID 134375939
9-(dihydroxyamino)-8-hydroxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 134375939) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 9-(dihydroxyamino)-8-hydroxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile.
| Compound Name | 9-(dihydroxyamino)-8-hydroxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 134375939 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 9-(dihydroxyamino)-8-hydroxy-6,6-dimethyl-11-oxo-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | CC1(C)c2cc(O)c(N(O)O)cc2C(=O)c2c1[nH]c1cc(C#N)ccc21 |
| InChI | InChI=1S/C19H15N3O4/c1-19(2)12-7-15(23)14(22(25)26)6-11(12)17(24)16-10-4-3-9(8-20)5-13(10)21-18(16)19/h3-7,21,23,25-26H,1-2H3 |
| InChIKey | CEUUWPPZRWVJGQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|