C56H41N3 — CID 170024729
2'-[bis(4-methylphenyl)methyl]-7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2,7-dicarbonitrile (PubChem CID 170024729) has the molecular formula C56H41N3 and a molecular weight of 755.97 g/mol. Its IUPAC name is 2'-[bis(4-methylphenyl)methyl]-7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2,7-dicarbonitrile.
| Compound Name | 2'-[bis(4-methylphenyl)methyl]-7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2,7-dicarbonitrile |
|---|---|
| PubChem CID | 170024729 |
| Molecular Formula | C56H41N3 |
| Molecular Weight | 755.97 g/mol |
| Exact Mass | 755.33 |
| IUPAC Name | 2'-[bis(4-methylphenyl)methyl]-7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2,7-dicarbonitrile |
| SMILES | Cc1ccc(C(c2ccc(C)cc2)c2ccc3c(c2)C2(c4cc(C#N)ccc4-c4ccc(C#N)cc42)c2cc(N(c4ccc(C)cc4)c4ccc(C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C56H41N3/c1-35-5-15-41(16-6-35)55(42-17-7-36(2)8-18-42)43-19-27-49-50-28-24-46(59(44-20-9-37(3)10-21-44)45-22-11-38(4)12-23-45)32-54(50)56(53(49)31-43)51-29-39(33-57)13-25-47(51)48-26-14-40(34-58)30-52(48)56/h5-32,55H,1-4H3 |
| InChIKey | MPLRMLRXVHPDNU-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.97 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|