C81H68N4O4 — CID 57337080
2-N,2-N',7-N,7-N'-tetrakis(4-methoxyphenyl)-2-N,2-N',7-N,7-N'-tetrakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine (PubChem CID 57337080) has the molecular formula C81H68N4O4 and a molecular weight of 1161.46 g/mol. Its IUPAC name is 2-N,2-N',7-N,7-N'-tetrakis(4-methoxyphenyl)-2-N,2-N',7-N,7-N'-tetrakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine.
| Compound Name | 2-N,2-N',7-N,7-N'-tetrakis(4-methoxyphenyl)-2-N,2-N',7-N,7-N'-tetrakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
|---|---|
| PubChem CID | 57337080 |
| Molecular Formula | C81H68N4O4 |
| Molecular Weight | 1161.46 g/mol |
| Exact Mass | 1160.52 |
| IUPAC Name | 2-N,2-N',7-N,7-N'-tetrakis(4-methoxyphenyl)-2-N,2-N',7-N,7-N'-tetrakis(4-methylphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine |
| SMILES | COc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C2(c4cc(N(c5ccc(C)cc5)c5ccc(OC)cc5)ccc4-3)c3cc(N(c4ccc(C)cc4)c4ccc(OC)cc4)ccc3-c3ccc(N(c4ccc(C)cc4)c4ccc(OC)cc4)cc32)cc1 |
| InChI | InChI=1S/C81H68N4O4/c1-53-9-17-57(18-10-53)82(61-25-37-69(86-5)38-26-61)65-33-45-73-74-46-34-66(83(58-19-11-54(2)12-20-58)62-27-39-70(87-6)40-28-62)50-78(74)81(77(73)49-65)79-51-67(84(59-21-13-55(3)14-22-59)63-29-41-71(88-7)42-30-63)35-47-75(79)76-48-36-68(52-80(76)81)85(60-23-15-56(4)16-24-60)64-31-43-72(89-8)44-32-64/h9-52H,1-8H3 |
| InChIKey | XKVBTCJAZAFUJP-UHFFFAOYSA-N |
| XLogP | 21.18 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1161.46 |
| LogP ≤ 5 | 21.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |