C61H60N2O2 — CID 161284315
2-N,7-N-bis(4-butoxyphenyl)-2-N,7-N,9,9-tetrakis(4-methylphenyl)fluorene-2,7-diamine (PubChem CID 161284315) has the molecular formula C61H60N2O2 and a molecular weight of 853.16 g/mol. Its IUPAC name is 2-N,7-N-bis(4-butoxyphenyl)-2-N,7-N,9,9-tetrakis(4-methylphenyl)fluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis(4-butoxyphenyl)-2-N,7-N,9,9-tetrakis(4-methylphenyl)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 161284315 |
| Molecular Formula | C61H60N2O2 |
| Molecular Weight | 853.16 g/mol |
| Exact Mass | 852.47 |
| IUPAC Name | 2-N,7-N-bis(4-butoxyphenyl)-2-N,7-N,9,9-tetrakis(4-methylphenyl)fluorene-2,7-diamine |
| SMILES | CCCCOc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C(c2ccc(C)cc2)(c2ccc(C)cc2)c2cc(N(c4ccc(C)cc4)c4ccc(OCCCC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C61H60N2O2/c1-7-9-39-64-55-33-27-51(28-34-55)62(49-23-15-45(5)16-24-49)53-31-37-57-58-38-32-54(63(50-25-17-46(6)18-26-50)52-29-35-56(36-30-52)65-40-10-8-2)42-60(58)61(59(57)41-53,47-19-11-43(3)12-20-47)48-21-13-44(4)14-22-48/h11-38,41-42H,7-10,39-40H2,1-6H3 |
| InChIKey | DWESRXDQXJMGAD-UHFFFAOYSA-N |
| XLogP | 16.58 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.16 |
| LogP ≤ 5 | 16.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|