C57H48N2 — CID 70848334
9,9-bis(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine (PubChem CID 70848334) has the molecular formula C57H48N2 and a molecular weight of 761.02 g/mol. Its IUPAC name is 9,9-bis(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine.
| Compound Name | 9,9-bis(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 70848334 |
| Molecular Formula | C57H48N2 |
| Molecular Weight | 761.02 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | 9,9-bis(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-2-N,2-N,7-N,7-N-tetrakis(4-methylphenyl)fluorene-2,7-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C(c2ccc4c(c2)CC4)(c2ccc4c(c2)CC4)c2cc(N(c4ccc(C)cc4)c4ccc(C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C57H48N2/c1-37-5-21-47(22-6-37)58(48-23-7-38(2)8-24-48)51-29-31-53-54-32-30-52(59(49-25-9-39(3)10-26-49)50-27-11-40(4)12-28-50)36-56(54)57(55(53)35-51,45-19-17-41-13-15-43(41)33-45)46-20-18-42-14-16-44(42)34-46/h5-12,17-36H,13-16H2,1-4H3 |
| InChIKey | ORAUYURNKHWYRO-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.02 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |