C61H60N2O8 — CID 139762391
2-N,2-N,7-N,7-N-tetrakis[4-(2-methoxyethoxy)phenyl]-9,9-diphenylfluorene-2,7-diamine (PubChem CID 139762391) has the molecular formula C61H60N2O8 and a molecular weight of 949.16 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis[4-(2-methoxyethoxy)phenyl]-9,9-diphenylfluorene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis[4-(2-methoxyethoxy)phenyl]-9,9-diphenylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 139762391 |
| Molecular Formula | C61H60N2O8 |
| Molecular Weight | 949.16 g/mol |
| Exact Mass | 948.43 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis[4-(2-methoxyethoxy)phenyl]-9,9-diphenylfluorene-2,7-diamine |
| SMILES | COCCOc1ccc(N(c2ccc(OCCOC)cc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(N(c4ccc(OCCOC)cc4)c4ccc(OCCOC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C61H60N2O8/c1-64-35-39-68-53-25-15-47(16-26-53)62(48-17-27-54(28-18-48)69-40-36-65-2)51-23-33-57-58-34-24-52(44-60(58)61(59(57)43-51,45-11-7-5-8-12-45)46-13-9-6-10-14-46)63(49-19-29-55(30-20-49)70-41-37-66-3)50-21-31-56(32-22-50)71-42-38-67-4/h5-34,43-44H,35-42H2,1-4H3 |
| InChIKey | PWNYAJROXMIKBR-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 80.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.16 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|