C81H68N4O8 — CID 167156209
2-N',2-N',3-N,3-N,6-N,6-N,7-N',7-N'-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2',3,6,7'-tetramine (PubChem CID 167156209) has the molecular formula C81H68N4O8 and a molecular weight of 1225.45 g/mol. Its IUPAC name is 2-N',2-N',3-N,3-N,6-N,6-N,7-N',7-N'-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2',3,6,7'-tetramine.
| Compound Name | 2-N',2-N',3-N,3-N,6-N,6-N,7-N',7-N'-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2',3,6,7'-tetramine |
|---|---|
| PubChem CID | 167156209 |
| Molecular Formula | C81H68N4O8 |
| Molecular Weight | 1225.45 g/mol |
| Exact Mass | 1224.50 |
| IUPAC Name | 2-N',2-N',3-N,3-N,6-N,6-N,7-N',7-N'-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2',3,6,7'-tetramine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)-c2cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc2C32c3cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc3-c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc32)cc1 |
| InChI | InChI=1S/C81H68N4O8/c1-86-65-29-9-53(10-30-65)82(54-11-31-66(87-2)32-12-54)61-27-47-77-75(49-61)76-50-62(83(55-13-33-67(88-3)34-14-55)56-15-35-68(89-4)36-16-56)28-48-78(76)81(77)79-51-63(84(57-17-37-69(90-5)38-18-57)58-19-39-70(91-6)40-20-58)25-45-73(79)74-46-26-64(52-80(74)81)85(59-21-41-71(92-7)42-22-59)60-23-43-72(93-8)44-24-60/h9-52H,1-8H3 |
| InChIKey | JKPNYHVVAGMKNG-UHFFFAOYSA-N |
| XLogP | 19.98 |
| TPSA | 86.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1225.45 |
| LogP ≤ 5 | 19.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |