C43H29N3 — CID 102209369
2-[[7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2'-yl]methylidene]propanedinitrile (PubChem CID 102209369) has the molecular formula C43H29N3 and a molecular weight of 587.73 g/mol. Its IUPAC name is 2-[[7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2'-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2'-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 102209369 |
| Molecular Formula | C43H29N3 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 2-[[7'-(4-methyl-N-(4-methylphenyl)anilino)-9,9'-spirobi[fluorene]-2'-yl]methylidene]propanedinitrile |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C2(c4ccccc4-c4ccccc42)c2cc(C=C(C#N)C#N)ccc2-3)cc1 |
| InChI | InChI=1S/C43H29N3/c1-28-11-16-32(17-12-28)46(33-18-13-29(2)14-19-33)34-20-22-38-37-21-15-30(23-31(26-44)27-45)24-41(37)43(42(38)25-34)39-9-5-3-7-35(39)36-8-4-6-10-40(36)43/h3-25H,1-2H3 |
| InChIKey | LDFSZEVRNHAXGO-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|