C28H23NO6Si — CID 147958465
6,11,16-trimethoxy-22-(4-methoxyphenyl)-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 147958465) has the molecular formula C28H23NO6Si and a molecular weight of 497.58 g/mol. Its IUPAC name is 6,11,16-trimethoxy-22-(4-methoxyphenyl)-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 6,11,16-trimethoxy-22-(4-methoxyphenyl)-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 147958465 |
| Molecular Formula | C28H23NO6Si |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 6,11,16-trimethoxy-22-(4-methoxyphenyl)-8,14-dioxa-22-aza-1-silahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | COc1ccc(N2c3ccc(OC)c4c3[SiH]3c5c(cc(OC)cc5Oc5c(OC)ccc2c53)O4)cc1 |
| InChI | InChI=1S/C28H23NO6Si/c1-30-16-7-5-15(6-8-16)29-18-9-11-20(32-3)24-26(18)36-27-19(29)10-12-21(33-4)25(27)35-23-14-17(31-2)13-22(34-24)28(23)36/h5-14,36H,1-4H3 |
| InChIKey | IOZTUCQAPFLKLP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|