C16H19BO2 — CID 177264772
(1,1,2,2-tetramethylacenaphthylen-4-yl)boronic acid (PubChem CID 177264772) has the molecular formula C16H19BO2 and a molecular weight of 254.14 g/mol. Its IUPAC name is (1,1,2,2-tetramethylacenaphthylen-4-yl)boronic acid.
| Compound Name | (1,1,2,2-tetramethylacenaphthylen-4-yl)boronic acid |
|---|---|
| PubChem CID | 177264772 |
| Molecular Formula | C16H19BO2 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1,1,2,2-tetramethylacenaphthylen-4-yl)boronic acid |
| SMILES | CC1(C)c2cccc3cc(B(O)O)cc(c23)C1(C)C |
| InChI | InChI=1S/C16H19BO2/c1-15(2)12-7-5-6-10-8-11(17(18)19)9-13(14(10)12)16(15,3)4/h5-9,18-19H,1-4H3 |
| InChIKey | CVBQCRVMTKVHTF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|