C38H68B2O4 — CID 70873992
2-[2,5-bis(2-butylhexyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 70873992) has the molecular formula C38H68B2O4 and a molecular weight of 610.58 g/mol. Its IUPAC name is 2-[2,5-bis(2-butylhexyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2,5-bis(2-butylhexyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 70873992 |
| Molecular Formula | C38H68B2O4 |
| Molecular Weight | 610.58 g/mol |
| Exact Mass | 610.53 |
| IUPAC Name | 2-[2,5-bis(2-butylhexyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCC(CCCC)Cc1cc(B2OC(C)(C)C(C)(C)O2)c(CC(CCCC)CCCC)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C38H68B2O4/c1-13-17-21-29(22-18-14-2)25-31-27-34(40-43-37(9,10)38(11,12)44-40)32(26-30(23-19-15-3)24-20-16-4)28-33(31)39-41-35(5,6)36(7,8)42-39/h27-30H,13-26H2,1-12H3 |
| InChIKey | QYPJTQUVBQUYAO-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.58 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|