C20H29BN2O4 — CID 114273974
1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propoxypyrazole (PubChem CID 114273974) has the molecular formula C20H29BN2O4 and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propoxypyrazole.
| Compound Name | 1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propoxypyrazole |
|---|---|
| PubChem CID | 114273974 |
| Molecular Formula | C20H29BN2O4 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-propoxypyrazole |
| SMILES | CCCOc1cnn(Cc2cc(OC)ccc2B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H29BN2O4/c1-7-10-25-17-12-22-23(14-17)13-15-11-16(24-6)8-9-18(15)21-26-19(2,3)20(4,5)27-21/h8-9,11-12,14H,7,10,13H2,1-6H3 |
| InChIKey | JUPVZECNFYCTOU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|