C21H34BNO3 — CID 113249561
1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylpiperidine (PubChem CID 113249561) has the molecular formula C21H34BNO3 and a molecular weight of 359.32 g/mol. Its IUPAC name is 1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylpiperidine.
| Compound Name | 1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 113249561 |
| Molecular Formula | C21H34BNO3 |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1-[[5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3,3-dimethylpiperidine |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)c(CN2CCCC(C)(C)C2)c1 |
| InChI | InChI=1S/C21H34BNO3/c1-19(2)11-8-12-23(15-19)14-16-13-17(24-7)9-10-18(16)22-25-20(3,4)21(5,6)26-22/h9-10,13H,8,11-12,14-15H2,1-7H3 |
| InChIKey | UPYVBJILBLGHPZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|