About 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine
1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine (PubChem CID 170588217) has the molecular formula C19H31NO2
and a molecular weight of 305.46 g/mol. Its IUPAC name is 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine |
| PubChem CID | 170588217 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine |
| SMILES | COc1ccc(CN2CCCC(C)(C)C2)c(OC)c1C(C)C |
| InChI | InChI=1S/C19H31NO2/c1-14(2)17-16(21-5)9-8-15(18(17)22-6)12-20-11-7-10-19(3,4)13-20/h8-9,14H,7,10-13H2,1-6H3 |
| InChIKey | WHQOHMUEOQOLQK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine?
The IUPAC name of 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine (CID 170588217) is 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine.
What is the SMILES notation for 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine?
The canonical SMILES for 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine is COc1ccc(CN2CCCC(C)(C)C2)c(OC)c1C(C)C.
What is the InChIKey of 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine?
The InChIKey is WHQOHMUEOQOLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO2/c1-14(2)17-16(21-5)9-8-15(18(17)22-6)12-20-11-7-10-19(3,4)13-20/h8-9,14H,7,10-13H2,1-6H3.
What are the key properties of 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine?
1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine has a molecular weight of 305.46 g/mol, XLogP of 4.45, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethoxy-3-propan-2-ylphenyl)methyl]-3,3-dimethylpiperidine is sourced from PubChem (CID 170588217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).