C20H28N2 — CID 170588954
4-[(3,3-dimethylpiperidin-1-yl)methyl]-1-propan-2-ylisoquinoline (PubChem CID 170588954) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 4-[(3,3-dimethylpiperidin-1-yl)methyl]-1-propan-2-ylisoquinoline.
| Compound Name | 4-[(3,3-dimethylpiperidin-1-yl)methyl]-1-propan-2-ylisoquinoline |
|---|---|
| PubChem CID | 170588954 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 4-[(3,3-dimethylpiperidin-1-yl)methyl]-1-propan-2-ylisoquinoline |
| SMILES | CC(C)c1ncc(CN2CCCC(C)(C)C2)c2ccccc12 |
| InChI | InChI=1S/C20H28N2/c1-15(2)19-18-9-6-5-8-17(18)16(12-21-19)13-22-11-7-10-20(3,4)14-22/h5-6,8-9,12,15H,7,10-11,13-14H2,1-4H3 |
| InChIKey | XTMBBXHJHPTEPS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |