C35H46N2O2 — CID 68533391
[4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperidin-1-yl]-(4-propylnaphthalen-1-yl)methanone (PubChem CID 68533391) has the molecular formula C35H46N2O2 and a molecular weight of 526.77 g/mol. Its IUPAC name is [4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperidin-1-yl]-(4-propylnaphthalen-1-yl)methanone.
| Compound Name | [4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperidin-1-yl]-(4-propylnaphthalen-1-yl)methanone |
|---|---|
| PubChem CID | 68533391 |
| Molecular Formula | C35H46N2O2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.36 |
| IUPAC Name | [4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]piperidin-1-yl]-(4-propylnaphthalen-1-yl)methanone |
| SMILES | CCCc1ccc(C(=O)N2CCC(c3ccc(OCCCN4CCCC(C)(C)C4)cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C35H46N2O2/c1-4-9-29-14-17-33(32-11-6-5-10-31(29)32)34(38)37-23-18-28(19-24-37)27-12-15-30(16-13-27)39-25-8-22-36-21-7-20-35(2,3)26-36/h5-6,10-17,28H,4,7-9,18-26H2,1-3H3 |
| InChIKey | YFOVOPVKUGXKGP-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|