C26H42N2O4 — CID 69128974
2-methylpropyl 4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 69128974) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is 2-methylpropyl 4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 69128974 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 2-methylpropyl 4-[4-[3-(3,3-dimethylpiperidin-1-yl)propoxy]phenyl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(O)(c2ccc(OCCCN3CCCC(C)(C)C3)cc2)CC1 |
| InChI | InChI=1S/C26H42N2O4/c1-21(2)19-32-24(29)28-16-12-26(30,13-17-28)22-7-9-23(10-8-22)31-18-6-15-27-14-5-11-25(3,4)20-27/h7-10,21,30H,5-6,11-20H2,1-4H3 |
| InChIKey | DKJRRXQKUMGWKL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|