C25H39N3O4 — CID 77446952
2-methylpropyl 4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 77446952) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is 2-methylpropyl 4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 77446952 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | 2-methylpropyl 4-[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCN(CC(=O)c2ccc(OCCCN3CCCC3C)cc2)CC1 |
| InChI | InChI=1S/C25H39N3O4/c1-20(2)19-32-25(30)28-15-13-26(14-16-28)18-24(29)22-7-9-23(10-8-22)31-17-5-12-27-11-4-6-21(27)3/h7-10,20-21H,4-6,11-19H2,1-3H3 |
| InChIKey | LDBRFLXYGOYTBE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|