C25H38N2O3 — CID 135221170
1-(1-methylcyclopropyl)-2-[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidin-1-yl]ethanone (PubChem CID 135221170) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-(1-methylcyclopropyl)-2-[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 1-(1-methylcyclopropyl)-2-[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 135221170 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 1-(1-methylcyclopropyl)-2-[4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidin-1-yl]ethanone |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc(OC2CCN(CC(=O)C3(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H38N2O3/c1-20-5-3-14-27(20)15-4-18-29-21-6-8-22(9-7-21)30-23-10-16-26(17-11-23)19-24(28)25(2)12-13-25/h6-9,20,23H,3-5,10-19H2,1-2H3/t20-/m1/s1 |
| InChIKey | BYPNZIHJPMTMBE-HXUWFJFHSA-N |
| XLogP | 4.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|