C22H34N2O4 — CID 86298856
ethyl 4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidine-1-carboxylate (PubChem CID 86298856) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl 4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86298856 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | ethyl 4-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenoxy]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Oc2ccc(OCCCN3CCC[C@H]3C)cc2)CC1 |
| InChI | InChI=1S/C22H34N2O4/c1-3-26-22(25)24-15-11-21(12-16-24)28-20-9-7-19(8-10-20)27-17-5-14-23-13-4-6-18(23)2/h7-10,18,21H,3-6,11-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | QHRWFGYBQBVLFS-GOSISDBHSA-N |
| XLogP | 3.94 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|